2-fluoro-4-(5-propyl-1,3,2-dioxaborinan-2-yl)benzoic acid

C13H16BFO4 — CID 14903224

IUPAC2-fluoro-4-(5-propyl-1,3,2-dioxaborinan-2-yl)benzoic acid
SMILESCCCC1COB(c2ccc(C(=O)O)c(F)c2)OC1
InChIInChI=1S/C13H16BFO4/c1-2-3-9-7-18-14(19-8-9)10-4-5-11(13(16)17)12(15)6-10/h4-6,9H,2-3,7-8H2,1H3,(H,16,17)
InChIKeyXONCDJDKCFRAIP-UHFFFAOYSA-N
MW266.08 g/mol
LogP1.68
Rot. Bonds4

About 2-fluoro-4-(5-propyl-1,3,2-dioxaborinan-2-yl)benzoic acid

2-fluoro-4-(5-propyl-1,3,2-dioxaborinan-2-yl)benzoic acid (PubChem CID 14903224) has the molecular formula C13H16BFO4 and a molecular weight of 266.08 g/mol. Its IUPAC name is 2-fluoro-4-(5-propyl-1,3,2-dioxaborinan-2-yl)benzoic acid.

Molecular Properties

Compound Name2-fluoro-4-(5-propyl-1,3,2-dioxaborinan-2-yl)benzoic acid
PubChem CID14903224
Molecular FormulaC13H16BFO4
Molecular Weight266.08 g/mol
Exact Mass266.11
IUPAC Name2-fluoro-4-(5-propyl-1,3,2-dioxaborinan-2-yl)benzoic acid
SMILESCCCC1COB(c2ccc(C(=O)O)c(F)c2)OC1
InChIInChI=1S/C13H16BFO4/c1-2-3-9-7-18-14(19-8-9)10-4-5-11(13(16)17)12(15)6-10/h4-6,9H,2-3,7-8H2,1H3,(H,16,17)
InChIKeyXONCDJDKCFRAIP-UHFFFAOYSA-N
XLogP1.68
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.08
LogP ≤ 51.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze 2-fluoro-4-(5-propyl-1,3,2-dioxaborinan-2-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-fluoro-4-(5-propyl-1,3,2-dioxaborinan-2-yl)benzoic acid?
The IUPAC name of 2-fluoro-4-(5-propyl-1,3,2-dioxaborinan-2-yl)benzoic acid (CID 14903224) is 2-fluoro-4-(5-propyl-1,3,2-dioxaborinan-2-yl)benzoic acid.
What is the SMILES notation for 2-fluoro-4-(5-propyl-1,3,2-dioxaborinan-2-yl)benzoic acid?
The canonical SMILES for 2-fluoro-4-(5-propyl-1,3,2-dioxaborinan-2-yl)benzoic acid is CCCC1COB(c2ccc(C(=O)O)c(F)c2)OC1.
What is the InChIKey of 2-fluoro-4-(5-propyl-1,3,2-dioxaborinan-2-yl)benzoic acid?
The InChIKey is XONCDJDKCFRAIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BFO4/c1-2-3-9-7-18-14(19-8-9)10-4-5-11(13(16)17)12(15)6-10/h4-6,9H,2-3,7-8H2,1H3,(H,16,17).
What are the key properties of 2-fluoro-4-(5-propyl-1,3,2-dioxaborinan-2-yl)benzoic acid?
2-fluoro-4-(5-propyl-1,3,2-dioxaborinan-2-yl)benzoic acid has a molecular weight of 266.08 g/mol, XLogP of 1.68, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-(5-propyl-1,3,2-dioxaborinan-2-yl)benzoic acid is sourced from PubChem (CID 14903224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).