C13H16BFO4 — CID 14903224
2-fluoro-4-(5-propyl-1,3,2-dioxaborinan-2-yl)benzoic acid (PubChem CID 14903224) has the molecular formula C13H16BFO4 and a molecular weight of 266.08 g/mol. Its IUPAC name is 2-fluoro-4-(5-propyl-1,3,2-dioxaborinan-2-yl)benzoic acid.
| Compound Name | 2-fluoro-4-(5-propyl-1,3,2-dioxaborinan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 14903224 |
| Molecular Formula | C13H16BFO4 |
| Molecular Weight | 266.08 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2-fluoro-4-(5-propyl-1,3,2-dioxaborinan-2-yl)benzoic acid |
| SMILES | CCCC1COB(c2ccc(C(=O)O)c(F)c2)OC1 |
| InChI | InChI=1S/C13H16BFO4/c1-2-3-9-7-18-14(19-8-9)10-4-5-11(13(16)17)12(15)6-10/h4-6,9H,2-3,7-8H2,1H3,(H,16,17) |
| InChIKey | XONCDJDKCFRAIP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.08 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|