C27H36BFO4 — CID 54266000
(3-methyl-4-pentylphenyl) 2-fluoro-4-(5-pentyl-1,3,2-dioxaborinan-2-yl)benzoate (PubChem CID 54266000) has the molecular formula C27H36BFO4 and a molecular weight of 454.39 g/mol. Its IUPAC name is (3-methyl-4-pentylphenyl) 2-fluoro-4-(5-pentyl-1,3,2-dioxaborinan-2-yl)benzoate.
| Compound Name | (3-methyl-4-pentylphenyl) 2-fluoro-4-(5-pentyl-1,3,2-dioxaborinan-2-yl)benzoate |
|---|---|
| PubChem CID | 54266000 |
| Molecular Formula | C27H36BFO4 |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | (3-methyl-4-pentylphenyl) 2-fluoro-4-(5-pentyl-1,3,2-dioxaborinan-2-yl)benzoate |
| SMILES | CCCCCc1ccc(OC(=O)c2ccc(B3OCC(CCCCC)CO3)cc2F)cc1C |
| InChI | InChI=1S/C27H36BFO4/c1-4-6-8-10-21-18-31-28(32-19-21)23-13-15-25(26(29)17-23)27(30)33-24-14-12-22(20(3)16-24)11-9-7-5-2/h12-17,21H,4-11,18-19H2,1-3H3 |
| InChIKey | RGUSURMYFYMOHQ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|