C23H40Si — CID 11325397
(2-ethenyl-4,6-dihexylphenyl)-trimethylsilane (PubChem CID 11325397) has the molecular formula C23H40Si and a molecular weight of 344.66 g/mol. Its IUPAC name is (2-ethenyl-4,6-dihexylphenyl)-trimethylsilane.
| Compound Name | (2-ethenyl-4,6-dihexylphenyl)-trimethylsilane |
|---|---|
| PubChem CID | 11325397 |
| Molecular Formula | C23H40Si |
| Molecular Weight | 344.66 g/mol |
| Exact Mass | 344.29 |
| IUPAC Name | (2-ethenyl-4,6-dihexylphenyl)-trimethylsilane |
| SMILES | C=Cc1cc(CCCCCC)cc(CCCCCC)c1[Si](C)(C)C |
| InChI | InChI=1S/C23H40Si/c1-7-10-12-14-16-20-18-21(9-3)23(24(4,5)6)22(19-20)17-15-13-11-8-2/h9,18-19H,3,7-8,10-17H2,1-2,4-6H3 |
| InChIKey | ZARIUJLXXICRMN-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.66 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|