C24H40 — CID 142098538
1-dodecyl-4-ethenyl-2,5-diethylbenzene (PubChem CID 142098538) has the molecular formula C24H40 and a molecular weight of 328.58 g/mol. Its IUPAC name is 1-dodecyl-4-ethenyl-2,5-diethylbenzene.
| Compound Name | 1-dodecyl-4-ethenyl-2,5-diethylbenzene |
|---|---|
| PubChem CID | 142098538 |
| Molecular Formula | C24H40 |
| Molecular Weight | 328.58 g/mol |
| Exact Mass | 328.31 |
| IUPAC Name | 1-dodecyl-4-ethenyl-2,5-diethylbenzene |
| SMILES | C=Cc1cc(CC)c(CCCCCCCCCCCC)cc1CC |
| InChI | InChI=1S/C24H40/c1-5-9-10-11-12-13-14-15-16-17-18-24-20-22(7-3)21(6-2)19-23(24)8-4/h6,19-20H,2,5,7-18H2,1,3-4H3 |
| InChIKey | PGQMPNVDHNBOKU-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.58 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|