C24H32 — CID 170744428
1-ethenyl-5-hexyl-2-methyl-4-(2,4,5-trimethylphenyl)benzene (PubChem CID 170744428) has the molecular formula C24H32 and a molecular weight of 320.52 g/mol. Its IUPAC name is 1-ethenyl-5-hexyl-2-methyl-4-(2,4,5-trimethylphenyl)benzene.
| Compound Name | 1-ethenyl-5-hexyl-2-methyl-4-(2,4,5-trimethylphenyl)benzene |
|---|---|
| PubChem CID | 170744428 |
| Molecular Formula | C24H32 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | 1-ethenyl-5-hexyl-2-methyl-4-(2,4,5-trimethylphenyl)benzene |
| SMILES | C=Cc1cc(CCCCCC)c(-c2cc(C)c(C)cc2C)cc1C |
| InChI | InChI=1S/C24H32/c1-7-9-10-11-12-22-16-21(8-2)19(5)15-24(22)23-14-18(4)17(3)13-20(23)6/h8,13-16H,2,7,9-12H2,1,3-6H3 |
| InChIKey | MIHLGUNHAARSJQ-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|