C23H38 — CID 123244940
5-ethenyl-1,2,3-tripentylbenzene (PubChem CID 123244940) has the molecular formula C23H38 and a molecular weight of 314.56 g/mol. Its IUPAC name is 5-ethenyl-1,2,3-tripentylbenzene.
| Compound Name | 5-ethenyl-1,2,3-tripentylbenzene |
|---|---|
| PubChem CID | 123244940 |
| Molecular Formula | C23H38 |
| Molecular Weight | 314.56 g/mol |
| Exact Mass | 314.30 |
| IUPAC Name | 5-ethenyl-1,2,3-tripentylbenzene |
| SMILES | C=Cc1cc(CCCCC)c(CCCCC)c(CCCCC)c1 |
| InChI | InChI=1S/C23H38/c1-5-9-12-15-21-18-20(8-4)19-22(16-13-10-6-2)23(21)17-14-11-7-3/h8,18-19H,4-7,9-17H2,1-3H3 |
| InChIKey | PSIKVONIMDHWOT-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.56 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|