C20H32NiO2 — CID 159198003
3-butyl-4,6-dipentylbenzene-1,2-diolate;nickel(2+) (PubChem CID 159198003) has the molecular formula C20H32NiO2 and a molecular weight of 363.17 g/mol. Its IUPAC name is 3-butyl-4,6-dipentylbenzene-1,2-diolate;nickel(2+).
| Compound Name | 3-butyl-4,6-dipentylbenzene-1,2-diolate;nickel(2+) |
|---|---|
| PubChem CID | 159198003 |
| Molecular Formula | C20H32NiO2 |
| Molecular Weight | 363.17 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 3-butyl-4,6-dipentylbenzene-1,2-diolate;nickel(2+) |
| SMILES | CCCCCc1cc(CCCCC)c(CCCC)c([O-])c1[O-].[Ni+2] |
| InChI | InChI=1S/C20H34O2.Ni/c1-4-7-10-12-16-15-17(13-11-8-5-2)19(21)20(22)18(16)14-9-6-3;/h15,21-22H,4-14H2,1-3H3;/q;+2/p-2 |
| InChIKey | KOXJLLPWQAHMIY-UHFFFAOYSA-L |
| XLogP | 4.64 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.17 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|