C14H20NiO2 — CID 162147422
4-ethyl-3-methyl-6-pentylbenzene-1,2-diolate;nickel(2+) (PubChem CID 162147422) has the molecular formula C14H20NiO2 and a molecular weight of 279.00 g/mol. Its IUPAC name is 4-ethyl-3-methyl-6-pentylbenzene-1,2-diolate;nickel(2+).
| Compound Name | 4-ethyl-3-methyl-6-pentylbenzene-1,2-diolate;nickel(2+) |
|---|---|
| PubChem CID | 162147422 |
| Molecular Formula | C14H20NiO2 |
| Molecular Weight | 279.00 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 4-ethyl-3-methyl-6-pentylbenzene-1,2-diolate;nickel(2+) |
| SMILES | CCCCCc1cc(CC)c(C)c([O-])c1[O-].[Ni+2] |
| InChI | InChI=1S/C14H22O2.Ni/c1-4-6-7-8-12-9-11(5-2)10(3)13(15)14(12)16;/h9,15-16H,4-8H2,1-3H3;/q;+2/p-2 |
| InChIKey | ZKTBDPLRPBUAPQ-UHFFFAOYSA-L |
| XLogP | 2.43 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.00 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|