C14H22 — CID 155667588
1-butyl-5-ethyl-2,4-dimethylbenzene (PubChem CID 155667588) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 1-butyl-5-ethyl-2,4-dimethylbenzene.
| Compound Name | 1-butyl-5-ethyl-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 155667588 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 1-butyl-5-ethyl-2,4-dimethylbenzene |
| SMILES | CCCCc1cc(CC)c(C)cc1C |
| InChI | InChI=1S/C14H22/c1-5-7-8-14-10-13(6-2)11(3)9-12(14)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | NYURGHOJBBYMNI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |