C25H46Si — CID 156630407
(3,5-dioctylphenyl)-trimethylsilane (PubChem CID 156630407) has the molecular formula C25H46Si and a molecular weight of 374.73 g/mol. Its IUPAC name is (3,5-dioctylphenyl)-trimethylsilane.
| Compound Name | (3,5-dioctylphenyl)-trimethylsilane |
|---|---|
| PubChem CID | 156630407 |
| Molecular Formula | C25H46Si |
| Molecular Weight | 374.73 g/mol |
| Exact Mass | 374.34 |
| IUPAC Name | (3,5-dioctylphenyl)-trimethylsilane |
| SMILES | CCCCCCCCc1cc(CCCCCCCC)cc([Si](C)(C)C)c1 |
| InChI | InChI=1S/C25H46Si/c1-6-8-10-12-14-16-18-23-20-24(19-17-15-13-11-9-7-2)22-25(21-23)26(3,4)5/h20-22H,6-19H2,1-5H3 |
| InChIKey | UCWVCVDZXDRAEB-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.73 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|