C27H44Si — CID 173383512
(3,5-dihexylphenyl)-(2,3-dimethylcyclopenta-2,4-dien-1-yl)-dimethylsilane (PubChem CID 173383512) has the molecular formula C27H44Si and a molecular weight of 396.74 g/mol. Its IUPAC name is (3,5-dihexylphenyl)-(2,3-dimethylcyclopenta-2,4-dien-1-yl)-dimethylsilane.
| Compound Name | (3,5-dihexylphenyl)-(2,3-dimethylcyclopenta-2,4-dien-1-yl)-dimethylsilane |
|---|---|
| PubChem CID | 173383512 |
| Molecular Formula | C27H44Si |
| Molecular Weight | 396.74 g/mol |
| Exact Mass | 396.32 |
| IUPAC Name | (3,5-dihexylphenyl)-(2,3-dimethylcyclopenta-2,4-dien-1-yl)-dimethylsilane |
| SMILES | CCCCCCc1cc(CCCCCC)cc([Si](C)(C)C2C=CC(C)=C2C)c1 |
| InChI | InChI=1S/C27H44Si/c1-7-9-11-13-15-24-19-25(16-14-12-10-8-2)21-26(20-24)28(5,6)27-18-17-22(3)23(27)4/h17-21,27H,7-16H2,1-6H3 |
| InChIKey | KBQBGPFRHWUHBF-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.74 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|