C29H48Si — CID 173383564
(2-butylcyclopenta-2,4-dien-1-yl)-(3,5-dihexylphenyl)-dimethylsilane (PubChem CID 173383564) has the molecular formula C29H48Si and a molecular weight of 424.79 g/mol. Its IUPAC name is (2-butylcyclopenta-2,4-dien-1-yl)-(3,5-dihexylphenyl)-dimethylsilane.
| Compound Name | (2-butylcyclopenta-2,4-dien-1-yl)-(3,5-dihexylphenyl)-dimethylsilane |
|---|---|
| PubChem CID | 173383564 |
| Molecular Formula | C29H48Si |
| Molecular Weight | 424.79 g/mol |
| Exact Mass | 424.35 |
| IUPAC Name | (2-butylcyclopenta-2,4-dien-1-yl)-(3,5-dihexylphenyl)-dimethylsilane |
| SMILES | CCCCCCc1cc(CCCCCC)cc([Si](C)(C)C2C=CC=C2CCCC)c1 |
| InChI | InChI=1S/C29H48Si/c1-6-9-12-14-17-25-22-26(18-15-13-10-7-2)24-28(23-25)30(4,5)29-21-16-20-27(29)19-11-8-3/h16,20-24,29H,6-15,17-19H2,1-5H3 |
| InChIKey | LWZWMJHYVGTVCB-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.79 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|