C9H16Si — CID 150574947
(2-butylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 150574947) has the molecular formula C9H16Si and a molecular weight of 152.31 g/mol. Its IUPAC name is (2-butylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | (2-butylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 150574947 |
| Molecular Formula | C9H16Si |
| Molecular Weight | 152.31 g/mol |
| Exact Mass | 152.10 |
| IUPAC Name | (2-butylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CCCCC1=CC=CC1[SiH3] |
| InChI | InChI=1S/C9H16Si/c1-2-3-5-8-6-4-7-9(8)10/h4,6-7,9H,2-3,5H2,1,10H3 |
| InChIKey | IMPMAMKHIJVQLU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|