C13H22Cl2Zr — CID 174628569
1,5-dibutylcyclopenta-1,3-diene;dichlorozirconium (PubChem CID 174628569) has the molecular formula C13H22Cl2Zr and a molecular weight of 340.45 g/mol. Its IUPAC name is 1,5-dibutylcyclopenta-1,3-diene;dichlorozirconium.
| Compound Name | 1,5-dibutylcyclopenta-1,3-diene;dichlorozirconium |
|---|---|
| PubChem CID | 174628569 |
| Molecular Formula | C13H22Cl2Zr |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 1,5-dibutylcyclopenta-1,3-diene;dichlorozirconium |
| SMILES | CCCCC1=CC=CC1CCCC.Cl[Zr]Cl |
| InChI | InChI=1S/C13H22.2ClH.Zr/c1-3-5-8-12-10-7-11-13(12)9-6-4-2;;;/h7,10-12H,3-6,8-9H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | KGANFUSZZJKRQG-UHFFFAOYSA-L |
| XLogP | 5.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |