C15H27N — CID 174837451
3-butyl-2-hexyl-1,2-dihydropyridine (PubChem CID 174837451) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is 3-butyl-2-hexyl-1,2-dihydropyridine.
| Compound Name | 3-butyl-2-hexyl-1,2-dihydropyridine |
|---|---|
| PubChem CID | 174837451 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 3-butyl-2-hexyl-1,2-dihydropyridine |
| SMILES | CCCCCCC1NC=CC=C1CCCC |
| InChI | InChI=1S/C15H27N/c1-3-5-7-8-12-15-14(10-6-4-2)11-9-13-16-15/h9,11,13,15-16H,3-8,10,12H2,1-2H3 |
| InChIKey | NGBWTFHXMAPUCZ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|