C21H38 — CID 173106521
1,5-dioctylcyclopenta-1,3-diene (PubChem CID 173106521) has the molecular formula C21H38 and a molecular weight of 290.54 g/mol. Its IUPAC name is 1,5-dioctylcyclopenta-1,3-diene.
| Compound Name | 1,5-dioctylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 173106521 |
| Molecular Formula | C21H38 |
| Molecular Weight | 290.54 g/mol |
| Exact Mass | 290.30 |
| IUPAC Name | 1,5-dioctylcyclopenta-1,3-diene |
| SMILES | CCCCCCCCC1=CC=CC1CCCCCCCC |
| InChI | InChI=1S/C21H38/c1-3-5-7-9-11-13-16-20-18-15-19-21(20)17-14-12-10-8-6-4-2/h15,18-20H,3-14,16-17H2,1-2H3 |
| InChIKey | UIIXQJQDTKRDAU-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.54 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|