C21H38 — CID 177419240
1,4-dihexyl-5-propylcyclohexa-1,3-diene (PubChem CID 177419240) has the molecular formula C21H38 and a molecular weight of 290.53 g/mol. Its IUPAC name is 1,4-dihexyl-5-propylcyclohexa-1,3-diene.
| Compound Name | 1,4-dihexyl-5-propylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 177419240 |
| Molecular Formula | C21H38 |
| Molecular Weight | 290.53 g/mol |
| Exact Mass | 290.30 |
| IUPAC Name | 1,4-dihexyl-5-propylcyclohexa-1,3-diene |
| SMILES | CCCCCCC1=CC=C(CCCCCC)C(CCC)C1 |
| InChI | InChI=1S/C21H38/c1-4-7-9-11-14-19-16-17-20(15-12-10-8-5-2)21(18-19)13-6-3/h16-17,21H,4-15,18H2,1-3H3 |
| InChIKey | YCRWNAGUSBABGM-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.53 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|