C11H14O2 — CID 132563823
3-[2-(3-oxopropyl)cyclopenta-2,4-dien-1-yl]propanal (PubChem CID 132563823) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 3-[2-(3-oxopropyl)cyclopenta-2,4-dien-1-yl]propanal.
| Compound Name | 3-[2-(3-oxopropyl)cyclopenta-2,4-dien-1-yl]propanal |
|---|---|
| PubChem CID | 132563823 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 3-[2-(3-oxopropyl)cyclopenta-2,4-dien-1-yl]propanal |
| SMILES | O=CCCC1=CC=CC1CCC=O |
| InChI | InChI=1S/C11H14O2/c12-8-2-6-10-4-1-5-11(10)7-3-9-13/h1,4-5,8-10H,2-3,6-7H2 |
| InChIKey | HSGJBCBAUCGSEM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|