C19H32O — CID 141201662
6-tridecylcyclohexa-2,4-dien-1-one (PubChem CID 141201662) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is 6-tridecylcyclohexa-2,4-dien-1-one.
| Compound Name | 6-tridecylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 141201662 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | 6-tridecylcyclohexa-2,4-dien-1-one |
| SMILES | CCCCCCCCCCCCCC1C=CC=CC1=O |
| InChI | InChI=1S/C19H32O/c1-2-3-4-5-6-7-8-9-10-11-12-15-18-16-13-14-17-19(18)20/h13-14,16-18H,2-12,15H2,1H3 |
| InChIKey | MCZBKVCHLRSNSX-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|