C20H26O — CID 177385826
(4R,5E)-5-benzylidene-4-octylcyclopent-2-en-1-one (PubChem CID 177385826) has the molecular formula C20H26O and a molecular weight of 282.43 g/mol. Its IUPAC name is (4R,5E)-5-benzylidene-4-octylcyclopent-2-en-1-one.
| Compound Name | (4R,5E)-5-benzylidene-4-octylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 177385826 |
| Molecular Formula | C20H26O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | (4R,5E)-5-benzylidene-4-octylcyclopent-2-en-1-one |
| SMILES | CCCCCCCC[C@@H]1C=CC(=O)/C1=C/c1ccccc1 |
| InChI | InChI=1S/C20H26O/c1-2-3-4-5-6-10-13-18-14-15-20(21)19(18)16-17-11-8-7-9-12-17/h7-9,11-12,14-16,18H,2-6,10,13H2,1H3/b19-16+/t18-/m1/s1 |
| InChIKey | UJHWLYWTAFGYMY-CQGUWYRNSA-N |
| XLogP | 5.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|