C16H20O3 — CID 88641425
7-(2-butyl-5-oxocyclopent-3-en-1-ylidene)hept-5-ynoic acid (PubChem CID 88641425) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 7-(2-butyl-5-oxocyclopent-3-en-1-ylidene)hept-5-ynoic acid.
| Compound Name | 7-(2-butyl-5-oxocyclopent-3-en-1-ylidene)hept-5-ynoic acid |
|---|---|
| PubChem CID | 88641425 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 7-(2-butyl-5-oxocyclopent-3-en-1-ylidene)hept-5-ynoic acid |
| SMILES | CCCCC1C=CC(=O)C1=CC#CCCCC(=O)O |
| InChI | InChI=1S/C16H20O3/c1-2-3-8-13-11-12-15(17)14(13)9-6-4-5-7-10-16(18)19/h9,11-13H,2-3,5,7-8,10H2,1H3,(H,18,19) |
| InChIKey | OTXWNLNTKIUUCV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|