C26H42O4Si — CID 102354571
7-[(1S,5Z)-5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctylidene]-4-oxocyclopent-2-en-1-yl]hept-5-ynoic acid (PubChem CID 102354571) has the molecular formula C26H42O4Si and a molecular weight of 446.70 g/mol. Its IUPAC name is 7-[(1S,5Z)-5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctylidene]-4-oxocyclopent-2-en-1-yl]hept-5-ynoic acid.
| Compound Name | 7-[(1S,5Z)-5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctylidene]-4-oxocyclopent-2-en-1-yl]hept-5-ynoic acid |
|---|---|
| PubChem CID | 102354571 |
| Molecular Formula | C26H42O4Si |
| Molecular Weight | 446.70 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | 7-[(1S,5Z)-5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctylidene]-4-oxocyclopent-2-en-1-yl]hept-5-ynoic acid |
| SMILES | CCCCC[C@@H](C/C=C1\C(=O)C=C[C@@H]1CC#CCCCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H42O4Si/c1-7-8-11-15-22(30-31(5,6)26(2,3)4)18-19-23-21(17-20-24(23)27)14-12-9-10-13-16-25(28)29/h17,19-22H,7-8,10-11,13-16,18H2,1-6H3,(H,28,29)/b23-19-/t21-,22-/m0/s1 |
| InChIKey | WQALJKJCZZCTSV-QGINCNFXSA-N |
| XLogP | 6.68 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.70 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|