C41H60O6 — CID 160562187
methane;bis((Z)-7-[(1S,5E)-5-[(E)-oct-2-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoic acid) (PubChem CID 160562187) has the molecular formula C41H60O6 and a molecular weight of 648.92 g/mol. Its IUPAC name is methane;bis((Z)-7-[(1S,5E)-5-[(E)-oct-2-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoic acid).
| Compound Name | methane;bis((Z)-7-[(1S,5E)-5-[(E)-oct-2-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoic acid) |
|---|---|
| PubChem CID | 160562187 |
| Molecular Formula | C41H60O6 |
| Molecular Weight | 648.92 g/mol |
| Exact Mass | 648.44 |
| IUPAC Name | methane;bis((Z)-7-[(1S,5E)-5-[(E)-oct-2-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoic acid) |
| SMILES | C.CCCCC/C=C/C=C1/C(=O)C=C[C@@H]1C/C=C\CCCC(=O)O.CCCCC/C=C/C=C1/C(=O)C=C[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/2C20H28O3.CH4/c2*1-2-3-4-5-6-10-13-18-17(15-16-19(18)21)12-9-7-8-11-14-20(22)23;/h2*6-7,9-10,13,15-17H,2-5,8,11-12,14H2,1H3,(H,22,23);1H4/b2*9-7-,10-6+,18-13+;/t2*17-;/m00./s1 |
| InChIKey | QZLPHQOLCYEFLS-WWZRBCNKSA-N |
| XLogP | 10.65 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.92 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|