C14H20O — CID 89313735
(4S,5E)-4-methyl-5-[(E)-oct-2-enylidene]cyclopent-2-en-1-one (PubChem CID 89313735) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is (4S,5E)-4-methyl-5-[(E)-oct-2-enylidene]cyclopent-2-en-1-one.
| Compound Name | (4S,5E)-4-methyl-5-[(E)-oct-2-enylidene]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 89313735 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (4S,5E)-4-methyl-5-[(E)-oct-2-enylidene]cyclopent-2-en-1-one |
| SMILES | CCCCC/C=C/C=C1/C(=O)C=C[C@@H]1C |
| InChI | InChI=1S/C14H20O/c1-3-4-5-6-7-8-9-13-12(2)10-11-14(13)15/h7-12H,3-6H2,1-2H3/b8-7+,13-9+/t12-/m0/s1 |
| InChIKey | JEJGUORDFWWGAT-IVIRYAKXSA-N |
| XLogP | 3.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|