C27H46O2 — CID 142538805
butane;ethane;(5E)-5-[(E)-oct-2-enylidene]-4-[(E)-7-oxooct-2-enyl]cyclopent-2-en-1-one (PubChem CID 142538805) has the molecular formula C27H46O2 and a molecular weight of 402.66 g/mol. Its IUPAC name is butane;ethane;(5E)-5-[(E)-oct-2-enylidene]-4-[(E)-7-oxooct-2-enyl]cyclopent-2-en-1-one.
| Compound Name | butane;ethane;(5E)-5-[(E)-oct-2-enylidene]-4-[(E)-7-oxooct-2-enyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 142538805 |
| Molecular Formula | C27H46O2 |
| Molecular Weight | 402.66 g/mol |
| Exact Mass | 402.35 |
| IUPAC Name | butane;ethane;(5E)-5-[(E)-oct-2-enylidene]-4-[(E)-7-oxooct-2-enyl]cyclopent-2-en-1-one |
| SMILES | CC.CCCC.CCCCC/C=C/C=C1/C(=O)C=CC1C/C=C/CCCC(C)=O |
| InChI | InChI=1S/C21H30O2.C4H10.C2H6/c1-3-4-5-6-7-12-15-20-19(16-17-21(20)23)14-11-9-8-10-13-18(2)22;1-3-4-2;1-2/h7,9,11-12,15-17,19H,3-6,8,10,13-14H2,1-2H3;3-4H2,1-2H3;1-2H3/b11-9+,12-7+,20-15+;; |
| InChIKey | LESUFPFTRNSCQN-DCXGCHPPSA-N |
| XLogP | 8.34 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.66 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|