C19H28O — CID 58060828
(4S,5E)-4-[(Z)-hept-2-enyl]-5-[(E)-hept-2-enylidene]cyclopent-2-en-1-one (PubChem CID 58060828) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is (4S,5E)-4-[(Z)-hept-2-enyl]-5-[(E)-hept-2-enylidene]cyclopent-2-en-1-one.
| Compound Name | (4S,5E)-4-[(Z)-hept-2-enyl]-5-[(E)-hept-2-enylidene]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 58060828 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | (4S,5E)-4-[(Z)-hept-2-enyl]-5-[(E)-hept-2-enylidene]cyclopent-2-en-1-one |
| SMILES | CCCC/C=C\C[C@H]1C=CC(=O)/C1=C/C=C/CCCC |
| InChI | InChI=1S/C19H28O/c1-3-5-7-9-11-13-17-15-16-19(20)18(17)14-12-10-8-6-4-2/h9-12,14-17H,3-8,13H2,1-2H3/b11-9-,12-10+,18-14+/t17-/m0/s1 |
| InChIKey | MVRPFVKPKZFIAK-VPJRYRHDSA-N |
| XLogP | 5.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|