C29H31NO7S2 — CID 123267126
N-(benzenesulfonyl)-7-[5-[4-(4-methoxyphenyl)sulfonylbut-2-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enamide (PubChem CID 123267126) has the molecular formula C29H31NO7S2 and a molecular weight of 569.70 g/mol. Its IUPAC name is N-(benzenesulfonyl)-7-[5-[4-(4-methoxyphenyl)sulfonylbut-2-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enamide.
| Compound Name | N-(benzenesulfonyl)-7-[5-[4-(4-methoxyphenyl)sulfonylbut-2-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enamide |
|---|---|
| PubChem CID | 123267126 |
| Molecular Formula | C29H31NO7S2 |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.15 |
| IUPAC Name | N-(benzenesulfonyl)-7-[5-[4-(4-methoxyphenyl)sulfonylbut-2-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enamide |
| SMILES | COc1ccc(S(=O)(=O)CC=CC=C2C(=O)C=CC2CC=CCCCC(=O)NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H31NO7S2/c1-37-24-17-19-25(20-18-24)38(33,34)22-10-9-14-27-23(16-21-28(27)31)11-5-2-3-8-15-29(32)30-39(35,36)26-12-6-4-7-13-26/h2,4-7,9-10,12-14,16-21,23H,3,8,11,15,22H2,1H3,(H,30,32) |
| InChIKey | MYSCCYVOGVXCLS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|