C27H32O3 — CID 122660120
cyclopropyl (Z)-7-[(5E)-5-[(E)-5-(3-methylphenyl)pent-2-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoate (PubChem CID 122660120) has the molecular formula C27H32O3 and a molecular weight of 404.55 g/mol. Its IUPAC name is cyclopropyl (Z)-7-[(5E)-5-[(E)-5-(3-methylphenyl)pent-2-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoate.
| Compound Name | cyclopropyl (Z)-7-[(5E)-5-[(E)-5-(3-methylphenyl)pent-2-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 122660120 |
| Molecular Formula | C27H32O3 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | cyclopropyl (Z)-7-[(5E)-5-[(E)-5-(3-methylphenyl)pent-2-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoate |
| SMILES | Cc1cccc(CC/C=C/C=C2/C(=O)C=CC2C/C=C\CCCC(=O)OC2CC2)c1 |
| InChI | InChI=1S/C27H32O3/c1-21-10-9-12-22(20-21)11-5-4-7-14-25-23(16-19-26(25)28)13-6-2-3-8-15-27(29)30-24-17-18-24/h2,4,6-7,9-10,12,14,16,19-20,23-24H,3,5,8,11,13,15,17-18H2,1H3/b6-2-,7-4+,25-14+ |
| InChIKey | PRRILBJKSYBEKJ-WWIKDHAISA-N |
| XLogP | 5.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|