C27H33F3O4 — CID 123798653
propan-2-yl 7-[5-[3-hydroxy-5-[3-(trifluoromethyl)phenyl]pentylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoate (PubChem CID 123798653) has the molecular formula C27H33F3O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is propan-2-yl 7-[5-[3-hydroxy-5-[3-(trifluoromethyl)phenyl]pentylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoate.
| Compound Name | propan-2-yl 7-[5-[3-hydroxy-5-[3-(trifluoromethyl)phenyl]pentylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 123798653 |
| Molecular Formula | C27H33F3O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | propan-2-yl 7-[5-[3-hydroxy-5-[3-(trifluoromethyl)phenyl]pentylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCCC=CCC1C=CC(=O)C1=CCC(O)CCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H33F3O4/c1-19(2)34-26(33)11-6-4-3-5-9-21-13-17-25(32)24(21)16-15-23(31)14-12-20-8-7-10-22(18-20)27(28,29)30/h3,5,7-8,10,13,16-19,21,23,31H,4,6,9,11-12,14-15H2,1-2H3 |
| InChIKey | HQFRRFHBFUMOEW-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|