C25H36O4 — CID 123217378
propan-2-yl 7-[5-[5-(1-bicyclo[1.1.1]pentanyl)-3-hydroxypentylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoate (PubChem CID 123217378) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is propan-2-yl 7-[5-[5-(1-bicyclo[1.1.1]pentanyl)-3-hydroxypentylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoate.
| Compound Name | propan-2-yl 7-[5-[5-(1-bicyclo[1.1.1]pentanyl)-3-hydroxypentylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 123217378 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | propan-2-yl 7-[5-[5-(1-bicyclo[1.1.1]pentanyl)-3-hydroxypentylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCCC=CCC1C=CC(=O)C1=CCC(O)CCC12CC(C1)C2 |
| InChI | InChI=1S/C25H36O4/c1-18(2)29-24(28)8-6-4-3-5-7-20-9-12-23(27)22(20)11-10-21(26)13-14-25-15-19(16-25)17-25/h3,5,9,11-12,18-21,26H,4,6-8,10,13-17H2,1-2H3 |
| InChIKey | CYHGWLFADDFCRV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|