C25H38O5 — CID 139625810
methyl 7-[2-[7-(oxan-2-yloxy)hept-2-enyl]-5-oxocyclopent-3-en-1-ylidene]heptanoate (PubChem CID 139625810) has the molecular formula C25H38O5 and a molecular weight of 418.57 g/mol. Its IUPAC name is methyl 7-[2-[7-(oxan-2-yloxy)hept-2-enyl]-5-oxocyclopent-3-en-1-ylidene]heptanoate.
| Compound Name | methyl 7-[2-[7-(oxan-2-yloxy)hept-2-enyl]-5-oxocyclopent-3-en-1-ylidene]heptanoate |
|---|---|
| PubChem CID | 139625810 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | methyl 7-[2-[7-(oxan-2-yloxy)hept-2-enyl]-5-oxocyclopent-3-en-1-ylidene]heptanoate |
| SMILES | COC(=O)CCCCCC=C1C(=O)C=CC1CC=CCCCCOC1CCCCO1 |
| InChI | InChI=1S/C25H38O5/c1-28-24(27)15-9-5-4-8-14-22-21(17-18-23(22)26)13-7-3-2-6-11-19-29-25-16-10-12-20-30-25/h3,7,14,17-18,21,25H,2,4-6,8-13,15-16,19-20H2,1H3 |
| InChIKey | WZNNZIWLSHAMOI-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|