C16H26O4 — CID 131863601
methyl (6Z,9E)-11-(1,3-dioxan-2-yl)undeca-6,9-dienoate (PubChem CID 131863601) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is methyl (6Z,9E)-11-(1,3-dioxan-2-yl)undeca-6,9-dienoate.
| Compound Name | methyl (6Z,9E)-11-(1,3-dioxan-2-yl)undeca-6,9-dienoate |
|---|---|
| PubChem CID | 131863601 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | methyl (6Z,9E)-11-(1,3-dioxan-2-yl)undeca-6,9-dienoate |
| SMILES | COC(=O)CCCC/C=C\C/C=C/CC1OCCCO1 |
| InChI | InChI=1S/C16H26O4/c1-18-15(17)11-8-6-4-2-3-5-7-9-12-16-19-13-10-14-20-16/h2-3,7,9,16H,4-6,8,10-14H2,1H3/b3-2-,9-7+ |
| InChIKey | LXYDHHJTBVPXRU-ZISRPPKGSA-N |
| XLogP | 3.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|