C19H32O3 — CID 78382159
methyl 14-(3-ethyloxiran-2-yl)tetradeca-9,12-dienoate (PubChem CID 78382159) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is methyl 14-(3-ethyloxiran-2-yl)tetradeca-9,12-dienoate.
| Compound Name | methyl 14-(3-ethyloxiran-2-yl)tetradeca-9,12-dienoate |
|---|---|
| PubChem CID | 78382159 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | methyl 14-(3-ethyloxiran-2-yl)tetradeca-9,12-dienoate |
| SMILES | CCC1OC1CC=CCC=CCCCCCCCC(=O)OC |
| InChI | InChI=1S/C19H32O3/c1-3-17-18(22-17)15-13-11-9-7-5-4-6-8-10-12-14-16-19(20)21-2/h5,7,11,13,17-18H,3-4,6,8-10,12,14-16H2,1-2H3 |
| InChIKey | WXOURJJDULGFAF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|