C21H38O3 — CID 87560636
methyl (Z)-16-(3-ethyloxiran-2-yl)hexadec-8-enoate (PubChem CID 87560636) has the molecular formula C21H38O3 and a molecular weight of 338.53 g/mol. Its IUPAC name is methyl (Z)-16-(3-ethyloxiran-2-yl)hexadec-8-enoate.
| Compound Name | methyl (Z)-16-(3-ethyloxiran-2-yl)hexadec-8-enoate |
|---|---|
| PubChem CID | 87560636 |
| Molecular Formula | C21H38O3 |
| Molecular Weight | 338.53 g/mol |
| Exact Mass | 338.28 |
| IUPAC Name | methyl (Z)-16-(3-ethyloxiran-2-yl)hexadec-8-enoate |
| SMILES | CCC1OC1CCCCCCC/C=C\CCCCCCC(=O)OC |
| InChI | InChI=1S/C21H38O3/c1-3-19-20(24-19)17-15-13-11-9-7-5-4-6-8-10-12-14-16-18-21(22)23-2/h4,6,19-20H,3,5,7-18H2,1-2H3/b6-4- |
| InChIKey | ISKWJZRDKRWRKB-XQRVVYSFSA-N |
| XLogP | 5.96 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.53 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|