C43H68O5 — CID 158013604
methane;methyl 16-(3-ethyloxiran-2-yl)hexadeca-5,11-diynoate;methyl (Z)-icos-17-en-5,11-diynoate (PubChem CID 158013604) has the molecular formula C43H68O5 and a molecular weight of 665.01 g/mol. Its IUPAC name is methane;methyl 16-(3-ethyloxiran-2-yl)hexadeca-5,11-diynoate;methyl (Z)-icos-17-en-5,11-diynoate.
| Compound Name | methane;methyl 16-(3-ethyloxiran-2-yl)hexadeca-5,11-diynoate;methyl (Z)-icos-17-en-5,11-diynoate |
|---|---|
| PubChem CID | 158013604 |
| Molecular Formula | C43H68O5 |
| Molecular Weight | 665.01 g/mol |
| Exact Mass | 664.51 |
| IUPAC Name | methane;methyl 16-(3-ethyloxiran-2-yl)hexadeca-5,11-diynoate;methyl (Z)-icos-17-en-5,11-diynoate |
| SMILES | C.CC/C=C\CCCCC#CCCCCC#CCCCC(=O)OC.CCC1OC1CCCCC#CCCCCC#CCCCC(=O)OC |
| InChI | InChI=1S/C21H32O3.C21H32O2.CH4/c1-3-19-20(24-19)17-15-13-11-9-7-5-4-6-8-10-12-14-16-18-21(22)23-2;1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22)23-2;/h19-20H,3-6,8,11,13-18H2,1-2H3;4-5H,3,6-9,12-15,18-20H2,1-2H3;1H4/b;5-4-; |
| InChIKey | FFEQZFNBDTXLIG-FXHNQCOHSA-N |
| XLogP | 10.69 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.01 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|