C20H34O3 — CID 11976915
methyl 9-[(2R,3R)-3-[(1E,5Z)-octa-1,5-dienyl]oxiran-2-yl]nonanoate (PubChem CID 11976915) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is methyl 9-[(2R,3R)-3-[(1E,5Z)-octa-1,5-dienyl]oxiran-2-yl]nonanoate.
| Compound Name | methyl 9-[(2R,3R)-3-[(1E,5Z)-octa-1,5-dienyl]oxiran-2-yl]nonanoate |
|---|---|
| PubChem CID | 11976915 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | methyl 9-[(2R,3R)-3-[(1E,5Z)-octa-1,5-dienyl]oxiran-2-yl]nonanoate |
| SMILES | CC/C=C\CC/C=C/[C@H]1O[C@@H]1CCCCCCCCC(=O)OC |
| InChI | InChI=1S/C20H34O3/c1-3-4-5-6-9-12-15-18-19(23-18)16-13-10-7-8-11-14-17-20(21)22-2/h4-5,12,15,18-19H,3,6-11,13-14,16-17H2,1-2H3/b5-4-,15-12+/t18-,19-/m1/s1 |
| InChIKey | VEGNTUNXPIQPFE-DGNFZGDKSA-N |
| XLogP | 5.35 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|