C30H44O3 — CID 158381153
(4R)-4-methylcyclopent-2-en-1-one;(E)-oct-2-enal;(4S,5E)-5-[(E)-oct-2-enylidene]-4-prop-2-enylcyclopent-2-en-1-one (PubChem CID 158381153) has the molecular formula C30H44O3 and a molecular weight of 452.68 g/mol. Its IUPAC name is (4R)-4-methylcyclopent-2-en-1-one;(E)-oct-2-enal;(4S,5E)-5-[(E)-oct-2-enylidene]-4-prop-2-enylcyclopent-2-en-1-one.
| Compound Name | (4R)-4-methylcyclopent-2-en-1-one;(E)-oct-2-enal;(4S,5E)-5-[(E)-oct-2-enylidene]-4-prop-2-enylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 158381153 |
| Molecular Formula | C30H44O3 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | (4R)-4-methylcyclopent-2-en-1-one;(E)-oct-2-enal;(4S,5E)-5-[(E)-oct-2-enylidene]-4-prop-2-enylcyclopent-2-en-1-one |
| SMILES | C=CC[C@H]1C=CC(=O)/C1=C/C=C/CCCCC.CCCCC/C=C/C=O.C[C@H]1C=CC(=O)C1 |
| InChI | InChI=1S/C16H22O.C8H14O.C6H8O/c1-3-5-6-7-8-9-11-15-14(10-4-2)12-13-16(15)17;1-2-3-4-5-6-7-8-9;1-5-2-3-6(7)4-5/h4,8-9,11-14H,2-3,5-7,10H2,1H3;6-8H,2-5H2,1H3;2-3,5H,4H2,1H3/b9-8+,15-11+;7-6+;/t14-;;5-/m0.0/s1 |
| InChIKey | GVUPICJPTYIDJT-QKRHFOCGSA-N |
| XLogP | 7.85 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|