C22H34O — CID 58657859
(5E)-4-[(E)-7-methyloct-2-enyl]-5-[(E)-oct-2-enylidene]cyclopent-2-en-1-one (PubChem CID 58657859) has the molecular formula C22H34O and a molecular weight of 314.51 g/mol. Its IUPAC name is (5E)-4-[(E)-7-methyloct-2-enyl]-5-[(E)-oct-2-enylidene]cyclopent-2-en-1-one.
| Compound Name | (5E)-4-[(E)-7-methyloct-2-enyl]-5-[(E)-oct-2-enylidene]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 58657859 |
| Molecular Formula | C22H34O |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | (5E)-4-[(E)-7-methyloct-2-enyl]-5-[(E)-oct-2-enylidene]cyclopent-2-en-1-one |
| SMILES | CCCCC/C=C/C=C1/C(=O)C=CC1C/C=C/CCCC(C)C |
| InChI | InChI=1S/C22H34O/c1-4-5-6-7-8-13-16-21-20(17-18-22(21)23)15-12-10-9-11-14-19(2)3/h8,10,12-13,16-20H,4-7,9,11,14-15H2,1-3H3/b12-10+,13-8+,21-16+ |
| InChIKey | JHSRECIEPHVYMG-LHSLTGOHSA-N |
| XLogP | 6.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|