C12H22O3Si — CID 139699569
(2-butylcyclopenta-2,4-dien-1-yl)-trimethoxysilane (PubChem CID 139699569) has the molecular formula C12H22O3Si and a molecular weight of 242.39 g/mol. Its IUPAC name is (2-butylcyclopenta-2,4-dien-1-yl)-trimethoxysilane.
| Compound Name | (2-butylcyclopenta-2,4-dien-1-yl)-trimethoxysilane |
|---|---|
| PubChem CID | 139699569 |
| Molecular Formula | C12H22O3Si |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (2-butylcyclopenta-2,4-dien-1-yl)-trimethoxysilane |
| SMILES | CCCCC1=CC=CC1[Si](OC)(OC)OC |
| InChI | InChI=1S/C12H22O3Si/c1-5-6-8-11-9-7-10-12(11)16(13-2,14-3)15-4/h7,9-10,12H,5-6,8H2,1-4H3 |
| InChIKey | OPGQJOCMZFGAED-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|