C39H52Si — CID 140852530
(2-butan-2-ylcyclopenta-2,4-dien-1-yl)-tris(4-butylphenyl)silane (PubChem CID 140852530) has the molecular formula C39H52Si and a molecular weight of 548.93 g/mol. Its IUPAC name is (2-butan-2-ylcyclopenta-2,4-dien-1-yl)-tris(4-butylphenyl)silane.
| Compound Name | (2-butan-2-ylcyclopenta-2,4-dien-1-yl)-tris(4-butylphenyl)silane |
|---|---|
| PubChem CID | 140852530 |
| Molecular Formula | C39H52Si |
| Molecular Weight | 548.93 g/mol |
| Exact Mass | 548.38 |
| IUPAC Name | (2-butan-2-ylcyclopenta-2,4-dien-1-yl)-tris(4-butylphenyl)silane |
| SMILES | CCCCc1ccc([Si](c2ccc(CCCC)cc2)(c2ccc(CCCC)cc2)C2C=CC=C2C(C)CC)cc1 |
| InChI | InChI=1S/C39H52Si/c1-6-10-14-32-19-25-35(26-20-32)40(39-18-13-17-38(39)31(5)9-4,36-27-21-33(22-28-36)15-11-7-2)37-29-23-34(24-30-37)16-12-8-3/h13,17-31,39H,6-12,14-16H2,1-5H3 |
| InChIKey | XPYBLSABKHJYLH-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.93 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|