C29H54 — CID 176687578
1-butyl-4-propan-2-ylbenzene;1,4-di(propan-2-yl)benzene;methane (PubChem CID 176687578) has the molecular formula C29H54 and a molecular weight of 402.75 g/mol. Its IUPAC name is 1-butyl-4-propan-2-ylbenzene;1,4-di(propan-2-yl)benzene;methane.
| Compound Name | 1-butyl-4-propan-2-ylbenzene;1,4-di(propan-2-yl)benzene;methane |
|---|---|
| PubChem CID | 176687578 |
| Molecular Formula | C29H54 |
| Molecular Weight | 402.75 g/mol |
| Exact Mass | 402.42 |
| IUPAC Name | 1-butyl-4-propan-2-ylbenzene;1,4-di(propan-2-yl)benzene;methane |
| SMILES | C.C.C.C.CC(C)c1ccc(C(C)C)cc1.CCCCc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C13H20.C12H18.4CH4/c1-4-5-6-12-7-9-13(10-8-12)11(2)3;1-9(2)11-5-7-12(8-6-11)10(3)4;;;;/h7-11H,4-6H2,1-3H3;5-10H,1-4H3;4*1H4 |
| InChIKey | WUKFDXMTRKLUSE-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.75 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |