About 4-butylbenzenethiol;4-propan-2-ylbenzenethiol
4-butylbenzenethiol;4-propan-2-ylbenzenethiol (PubChem CID 162129320) has the molecular formula C19H26S2
and a molecular weight of 318.55 g/mol. Its IUPAC name is 4-butylbenzenethiol;4-propan-2-ylbenzenethiol.
Molecular Properties
| Compound Name | 4-butylbenzenethiol;4-propan-2-ylbenzenethiol |
| PubChem CID | 162129320 |
| Molecular Formula | C19H26S2 |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 4-butylbenzenethiol;4-propan-2-ylbenzenethiol |
| SMILES | CC(C)c1ccc(S)cc1.CCCCc1ccc(S)cc1 |
| InChI | InChI=1S/C10H14S.C9H12S/c1-2-3-4-9-5-7-10(11)8-6-9;1-7(2)8-3-5-9(10)6-4-8/h5-8,11H,2-4H2,1H3;3-7,10H,1-2H3 |
| InChIKey | ZILNAJGVPQSLJN-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-butylbenzenethiol;4-propan-2-ylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butylbenzenethiol;4-propan-2-ylbenzenethiol?
The IUPAC name of 4-butylbenzenethiol;4-propan-2-ylbenzenethiol (CID 162129320) is 4-butylbenzenethiol;4-propan-2-ylbenzenethiol.
What is the SMILES notation for 4-butylbenzenethiol;4-propan-2-ylbenzenethiol?
The canonical SMILES for 4-butylbenzenethiol;4-propan-2-ylbenzenethiol is CC(C)c1ccc(S)cc1.CCCCc1ccc(S)cc1.
What is the InChIKey of 4-butylbenzenethiol;4-propan-2-ylbenzenethiol?
The InChIKey is ZILNAJGVPQSLJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14S.C9H12S/c1-2-3-4-9-5-7-10(11)8-6-9;1-7(2)8-3-5-9(10)6-4-8/h5-8,11H,2-4H2,1H3;3-7,10H,1-2H3.
What are the key properties of 4-butylbenzenethiol;4-propan-2-ylbenzenethiol?
4-butylbenzenethiol;4-propan-2-ylbenzenethiol has a molecular weight of 318.55 g/mol, XLogP of 6.42, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butylbenzenethiol;4-propan-2-ylbenzenethiol is sourced from PubChem (CID 162129320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).