About 1-butyl-4-propan-2-ylbenzene;ethane;4-(4-hydroxyphenyl)phenol
1-butyl-4-propan-2-ylbenzene;ethane;4-(4-hydroxyphenyl)phenol (PubChem CID 158673942) has the molecular formula C27H36O2
and a molecular weight of 392.58 g/mol. Its IUPAC name is 1-butyl-4-propan-2-ylbenzene;ethane;4-(4-hydroxyphenyl)phenol.
Molecular Properties
| Compound Name | 1-butyl-4-propan-2-ylbenzene;ethane;4-(4-hydroxyphenyl)phenol |
| PubChem CID | 158673942 |
| Molecular Formula | C27H36O2 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | 1-butyl-4-propan-2-ylbenzene;ethane;4-(4-hydroxyphenyl)phenol |
| SMILES | CC.CCCCc1ccc(C(C)C)cc1.Oc1ccc(-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C13H20.C12H10O2.C2H6/c1-4-5-6-12-7-9-13(10-8-12)11(2)3;13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;1-2/h7-11H,4-6H2,1-3H3;1-8,13-14H;1-2H3 |
| InChIKey | IEGYHYVKFAIICV-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-butyl-4-propan-2-ylbenzene;ethane;4-(4-hydroxyphenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4-propan-2-ylbenzene;ethane;4-(4-hydroxyphenyl)phenol?
The IUPAC name of 1-butyl-4-propan-2-ylbenzene;ethane;4-(4-hydroxyphenyl)phenol (CID 158673942) is 1-butyl-4-propan-2-ylbenzene;ethane;4-(4-hydroxyphenyl)phenol.
What is the SMILES notation for 1-butyl-4-propan-2-ylbenzene;ethane;4-(4-hydroxyphenyl)phenol?
The canonical SMILES for 1-butyl-4-propan-2-ylbenzene;ethane;4-(4-hydroxyphenyl)phenol is CC.CCCCc1ccc(C(C)C)cc1.Oc1ccc(-c2ccc(O)cc2)cc1.
What is the InChIKey of 1-butyl-4-propan-2-ylbenzene;ethane;4-(4-hydroxyphenyl)phenol?
The InChIKey is IEGYHYVKFAIICV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20.C12H10O2.C2H6/c1-4-5-6-12-7-9-13(10-8-12)11(2)3;13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;1-2/h7-11H,4-6H2,1-3H3;1-8,13-14H;1-2H3.
What are the key properties of 1-butyl-4-propan-2-ylbenzene;ethane;4-(4-hydroxyphenyl)phenol?
1-butyl-4-propan-2-ylbenzene;ethane;4-(4-hydroxyphenyl)phenol has a molecular weight of 392.58 g/mol, XLogP of 7.94, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4-propan-2-ylbenzene;ethane;4-(4-hydroxyphenyl)phenol is sourced from PubChem (CID 158673942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).