C39H51SiTi- — CID 173494790
(3-butan-2-ylcyclopenta-2,4-dien-1-yl)-tris(4-butylphenyl)silane;titanium (PubChem CID 173494790) has the molecular formula C39H51SiTi- and a molecular weight of 595.79 g/mol. Its IUPAC name is (3-butan-2-ylcyclopenta-2,4-dien-1-yl)-tris(4-butylphenyl)silane;titanium.
| Compound Name | (3-butan-2-ylcyclopenta-2,4-dien-1-yl)-tris(4-butylphenyl)silane;titanium |
|---|---|
| PubChem CID | 173494790 |
| Molecular Formula | C39H51SiTi- |
| Molecular Weight | 595.79 g/mol |
| Exact Mass | 595.32 |
| IUPAC Name | (3-butan-2-ylcyclopenta-2,4-dien-1-yl)-tris(4-butylphenyl)silane;titanium |
| SMILES | CCCCc1ccc([Si](c2ccc(CCCC)cc2)(c2ccc(CCCC)cc2)[c-]2ccc(C(C)CC)c2)cc1.[Ti] |
| InChI | InChI=1S/C39H51Si.Ti/c1-6-10-13-32-16-23-36(24-17-32)40(39-29-22-35(30-39)31(5)9-4,37-25-18-33(19-26-37)14-11-7-2)38-27-20-34(21-28-38)15-12-8-3;/h16-31H,6-15H2,1-5H3;/q-1; |
| InChIKey | ZCPAXRQZAGOKSM-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.79 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|