C24H38Mg — CID 169222878
magnesium bis(2-butan-2-yl-5-propan-2-ylcyclopenta-1,3-diene) (PubChem CID 169222878) has the molecular formula C24H38Mg and a molecular weight of 350.87 g/mol. Its IUPAC name is magnesium bis(2-butan-2-yl-5-propan-2-ylcyclopenta-1,3-diene).
| Compound Name | magnesium bis(2-butan-2-yl-5-propan-2-ylcyclopenta-1,3-diene) |
|---|---|
| PubChem CID | 169222878 |
| Molecular Formula | C24H38Mg |
| Molecular Weight | 350.87 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | magnesium bis(2-butan-2-yl-5-propan-2-ylcyclopenta-1,3-diene) |
| SMILES | CCC(C)c1cc[c-](C(C)C)c1.CCC(C)c1cc[c-](C(C)C)c1.[Mg+2] |
| InChI | InChI=1S/2C12H19.Mg/c2*1-5-10(4)12-7-6-11(8-12)9(2)3;/h2*6-10H,5H2,1-4H3;/q2*-1;+2 |
| InChIKey | PXDLEBZZMGBYRG-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.87 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|