About 5-butylcyclohexa-2,4-dien-1-amine
5-butylcyclohexa-2,4-dien-1-amine (PubChem CID 146424387) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 5-butylcyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 5-butylcyclohexa-2,4-dien-1-amine |
| PubChem CID | 146424387 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 5-butylcyclohexa-2,4-dien-1-amine |
| SMILES | CCCCC1=CC=CC(N)C1 |
| InChI | InChI=1S/C10H17N/c1-2-3-5-9-6-4-7-10(11)8-9/h4,6-7,10H,2-3,5,8,11H2,1H3 |
| InChIKey | NAINOZXLMVKRSO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-butylcyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butylcyclohexa-2,4-dien-1-amine?
The IUPAC name of 5-butylcyclohexa-2,4-dien-1-amine (CID 146424387) is 5-butylcyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 5-butylcyclohexa-2,4-dien-1-amine?
The canonical SMILES for 5-butylcyclohexa-2,4-dien-1-amine is CCCCC1=CC=CC(N)C1.
What is the InChIKey of 5-butylcyclohexa-2,4-dien-1-amine?
The InChIKey is NAINOZXLMVKRSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-2-3-5-9-6-4-7-10(11)8-9/h4,6-7,10H,2-3,5,8,11H2,1H3.
What are the key properties of 5-butylcyclohexa-2,4-dien-1-amine?
5-butylcyclohexa-2,4-dien-1-amine has a molecular weight of 151.25 g/mol, XLogP of 2.39, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butylcyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 146424387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).