C9H11N — CID 165102050
5-prop-1-ynylcyclohexa-2,4-dien-1-amine (PubChem CID 165102050) has the molecular formula C9H11N and a molecular weight of 133.19 g/mol. Its IUPAC name is 5-prop-1-ynylcyclohexa-2,4-dien-1-amine.
| Compound Name | 5-prop-1-ynylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 165102050 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 5-prop-1-ynylcyclohexa-2,4-dien-1-amine |
| SMILES | CC#CC1=CC=CC(N)C1 |
| InChI | InChI=1S/C9H11N/c1-2-4-8-5-3-6-9(10)7-8/h3,5-6,9H,7,10H2,1H3 |
| InChIKey | YMMWWWYGHBEBMV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|