C15H14 — CID 15394481
2-(5-methylcyclohexa-1,3-dien-1-yl)ethynylbenzene (PubChem CID 15394481) has the molecular formula C15H14 and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-(5-methylcyclohexa-1,3-dien-1-yl)ethynylbenzene.
| Compound Name | 2-(5-methylcyclohexa-1,3-dien-1-yl)ethynylbenzene |
|---|---|
| PubChem CID | 15394481 |
| Molecular Formula | C15H14 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-(5-methylcyclohexa-1,3-dien-1-yl)ethynylbenzene |
| SMILES | CC1C=CC=C(C#Cc2ccccc2)C1 |
| InChI | InChI=1S/C15H14/c1-13-6-5-9-15(12-13)11-10-14-7-3-2-4-8-14/h2-9,13H,12H2,1H3 |
| InChIKey | ZMPSQQFXHOCFKO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|