C19H14 — CID 102382903
1-(2-cyclopenta-1,3-dien-1-ylethynyl)-4-phenylbenzene (PubChem CID 102382903) has the molecular formula C19H14 and a molecular weight of 242.32 g/mol. Its IUPAC name is 1-(2-cyclopenta-1,3-dien-1-ylethynyl)-4-phenylbenzene.
| Compound Name | 1-(2-cyclopenta-1,3-dien-1-ylethynyl)-4-phenylbenzene |
|---|---|
| PubChem CID | 102382903 |
| Molecular Formula | C19H14 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 1-(2-cyclopenta-1,3-dien-1-ylethynyl)-4-phenylbenzene |
| SMILES | C(#Cc1ccc(-c2ccccc2)cc1)C1=CC=CC1 |
| InChI | InChI=1S/C19H14/c1-2-8-18(9-3-1)19-14-12-17(13-15-19)11-10-16-6-4-5-7-16/h1-6,8-9,12-15H,7H2 |
| InChIKey | HZGLXGJSNCPFCY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|