C20H14 — CID 138976001
1-(2-cyclopenta-1,3-dien-1-ylethynyl)-4-(2-cyclopenta-1,4-dien-1-ylethynyl)benzene (PubChem CID 138976001) has the molecular formula C20H14 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-(2-cyclopenta-1,3-dien-1-ylethynyl)-4-(2-cyclopenta-1,4-dien-1-ylethynyl)benzene.
| Compound Name | 1-(2-cyclopenta-1,3-dien-1-ylethynyl)-4-(2-cyclopenta-1,4-dien-1-ylethynyl)benzene |
|---|---|
| PubChem CID | 138976001 |
| Molecular Formula | C20H14 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 1-(2-cyclopenta-1,3-dien-1-ylethynyl)-4-(2-cyclopenta-1,4-dien-1-ylethynyl)benzene |
| SMILES | C(#Cc1ccc(C#CC2=CC=CC2)cc1)C1=CCC=C1 |
| InChI | InChI=1S/C20H14/c1-2-6-17(5-1)9-11-19-13-15-20(16-14-19)12-10-18-7-3-4-8-18/h1-3,5,7-8,13-16H,4,6H2 |
| InChIKey | KFKLFVIYEXSFDE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|